C9H7F2O3- — CID 19770355
3-(2,3-difluorophenyl)-3-hydroxypropanoate (PubChem CID 19770355) has the molecular formula C9H7F2O3- and a molecular weight of 201.15 g/mol. Its IUPAC name is 3-(2,3-difluorophenyl)-3-hydroxypropanoate.
| Compound Name | 3-(2,3-difluorophenyl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 19770355 |
| Molecular Formula | C9H7F2O3- |
| Molecular Weight | 201.15 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 3-(2,3-difluorophenyl)-3-hydroxypropanoate |
| SMILES | O=C([O-])CC(O)c1cccc(F)c1F |
| InChI | InChI=1S/C9H8F2O3/c10-6-3-1-2-5(9(6)11)7(12)4-8(13)14/h1-3,7,12H,4H2,(H,13,14)/p-1 |
| InChIKey | QSMIBIRWJGUNKQ-UHFFFAOYSA-M |
| XLogP | 0.14 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.15 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |