About 1-(2,3-difluorophenyl)-3,3-difluoro-1-[fluoro-bis(trifluoromethylsulfonyl)methyl]urea
1-(2,3-difluorophenyl)-3,3-difluoro-1-[fluoro-bis(trifluoromethylsulfonyl)methyl]urea (PubChem CID 87641447) has the molecular formula C10H3F11N2O5S2
and a molecular weight of 504.26 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-3,3-difluoro-1-[fluoro-bis(trifluoromethylsulfonyl)methyl]urea.
Molecular Properties
| Compound Name | 1-(2,3-difluorophenyl)-3,3-difluoro-1-[fluoro-bis(trifluoromethylsulfonyl)methyl]urea |
| PubChem CID | 87641447 |
| Molecular Formula | C10H3F11N2O5S2 |
| Molecular Weight | 504.26 g/mol |
| Exact Mass | 503.93 |
| IUPAC Name | 1-(2,3-difluorophenyl)-3,3-difluoro-1-[fluoro-bis(trifluoromethylsulfonyl)methyl]urea |
| SMILES | O=C(N(F)F)N(c1cccc(F)c1F)C(F)(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H3F11N2O5S2/c11-4-2-1-3-5(6(4)12)22(7(24)23(20)21)10(19,29(25,26)8(13,14)15)30(27,28)9(16,17)18/h1-3H |
| InChIKey | NAQLKOVEUUYYRM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 504.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,3-difluorophenyl)-3,3-difluoro-1-[fluoro-bis(trifluoromethylsulfonyl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-difluorophenyl)-3,3-difluoro-1-[fluoro-bis(trifluoromethylsulfonyl)methyl]urea?
The IUPAC name of 1-(2,3-difluorophenyl)-3,3-difluoro-1-[fluoro-bis(trifluoromethylsulfonyl)methyl]urea (CID 87641447) is 1-(2,3-difluorophenyl)-3,3-difluoro-1-[fluoro-bis(trifluoromethylsulfonyl)methyl]urea.
What is the SMILES notation for 1-(2,3-difluorophenyl)-3,3-difluoro-1-[fluoro-bis(trifluoromethylsulfonyl)methyl]urea?
The canonical SMILES for 1-(2,3-difluorophenyl)-3,3-difluoro-1-[fluoro-bis(trifluoromethylsulfonyl)methyl]urea is O=C(N(F)F)N(c1cccc(F)c1F)C(F)(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F.
What is the InChIKey of 1-(2,3-difluorophenyl)-3,3-difluoro-1-[fluoro-bis(trifluoromethylsulfonyl)methyl]urea?
The InChIKey is NAQLKOVEUUYYRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H3F11N2O5S2/c11-4-2-1-3-5(6(4)12)22(7(24)23(20)21)10(19,29(25,26)8(13,14)15)30(27,28)9(16,17)18/h1-3H.
What are the key properties of 1-(2,3-difluorophenyl)-3,3-difluoro-1-[fluoro-bis(trifluoromethylsulfonyl)methyl]urea?
1-(2,3-difluorophenyl)-3,3-difluoro-1-[fluoro-bis(trifluoromethylsulfonyl)methyl]urea has a molecular weight of 504.26 g/mol, XLogP of 3.41, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-difluorophenyl)-3,3-difluoro-1-[fluoro-bis(trifluoromethylsulfonyl)methyl]urea is sourced from PubChem (CID 87641447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).