C10H3F11N2O5S2 — CID 87641447
1-(2,3-difluorophenyl)-3,3-difluoro-1-[fluoro-bis(trifluoromethylsulfonyl)methyl]urea (PubChem CID 87641447) has the molecular formula C10H3F11N2O5S2 and a molecular weight of 504.26 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-3,3-difluoro-1-[fluoro-bis(trifluoromethylsulfonyl)methyl]urea.
| Compound Name | 1-(2,3-difluorophenyl)-3,3-difluoro-1-[fluoro-bis(trifluoromethylsulfonyl)methyl]urea |
|---|---|
| PubChem CID | 87641447 |
| Molecular Formula | C10H3F11N2O5S2 |
| Molecular Weight | 504.26 g/mol |
| Exact Mass | 503.93 |
| IUPAC Name | 1-(2,3-difluorophenyl)-3,3-difluoro-1-[fluoro-bis(trifluoromethylsulfonyl)methyl]urea |
| SMILES | O=C(N(F)F)N(c1cccc(F)c1F)C(F)(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H3F11N2O5S2/c11-4-2-1-3-5(6(4)12)22(7(24)23(20)21)10(19,29(25,26)8(13,14)15)30(27,28)9(16,17)18/h1-3H |
| InChIKey | NAQLKOVEUUYYRM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|