About N-[[ethyl(dimethoxy)silyl]-difluoromethyl]-N,2,3-trifluoroaniline
N-[[ethyl(dimethoxy)silyl]-difluoromethyl]-N,2,3-trifluoroaniline (PubChem CID 90172459) has the molecular formula C11H14F5NO2Si
and a molecular weight of 315.31 g/mol. Its IUPAC name is N-[[ethyl(dimethoxy)silyl]-difluoromethyl]-N,2,3-trifluoroaniline.
Molecular Properties
| Compound Name | N-[[ethyl(dimethoxy)silyl]-difluoromethyl]-N,2,3-trifluoroaniline |
| PubChem CID | 90172459 |
| Molecular Formula | C11H14F5NO2Si |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N-[[ethyl(dimethoxy)silyl]-difluoromethyl]-N,2,3-trifluoroaniline |
| SMILES | CC[Si](OC)(OC)C(F)(F)N(F)c1cccc(F)c1F |
| InChI | InChI=1S/C11H14F5NO2Si/c1-4-20(18-2,19-3)11(14,15)17(16)9-7-5-6-8(12)10(9)13/h5-7H,4H2,1-3H3 |
| InChIKey | PUKUQTIORVHTDJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-[[ethyl(dimethoxy)silyl]-difluoromethyl]-N,2,3-trifluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[ethyl(dimethoxy)silyl]-difluoromethyl]-N,2,3-trifluoroaniline?
The IUPAC name of N-[[ethyl(dimethoxy)silyl]-difluoromethyl]-N,2,3-trifluoroaniline (CID 90172459) is N-[[ethyl(dimethoxy)silyl]-difluoromethyl]-N,2,3-trifluoroaniline.
What is the SMILES notation for N-[[ethyl(dimethoxy)silyl]-difluoromethyl]-N,2,3-trifluoroaniline?
The canonical SMILES for N-[[ethyl(dimethoxy)silyl]-difluoromethyl]-N,2,3-trifluoroaniline is CC[Si](OC)(OC)C(F)(F)N(F)c1cccc(F)c1F.
What is the InChIKey of N-[[ethyl(dimethoxy)silyl]-difluoromethyl]-N,2,3-trifluoroaniline?
The InChIKey is PUKUQTIORVHTDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F5NO2Si/c1-4-20(18-2,19-3)11(14,15)17(16)9-7-5-6-8(12)10(9)13/h5-7H,4H2,1-3H3.
What are the key properties of N-[[ethyl(dimethoxy)silyl]-difluoromethyl]-N,2,3-trifluoroaniline?
N-[[ethyl(dimethoxy)silyl]-difluoromethyl]-N,2,3-trifluoroaniline has a molecular weight of 315.31 g/mol, XLogP of 3.54, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[ethyl(dimethoxy)silyl]-difluoromethyl]-N,2,3-trifluoroaniline is sourced from PubChem (CID 90172459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).