2-(N-(3-ethoxy-3-oxopropyl)-2,3-difluoroanilino)acetic acid

C13H15F2NO4 — CID 23052753

IUPAC2-(N-(3-ethoxy-3-oxopropyl)-2,3-difluoroanilino)acetic acid
SMILESCCOC(=O)CCN(CC(=O)O)c1cccc(F)c1F
InChIInChI=1S/C13H15F2NO4/c1-2-20-12(19)6-7-16(8-11(17)18)10-5-3-4-9(14)13(10)15/h3-5H,2,6-8H2,1H3,(H,17,18)
InChIKeyWPYCTMFTBBLOQY-UHFFFAOYSA-N
MW287.26 g/mol
LogP1.81
Rot. Bonds7

About 2-(N-(3-ethoxy-3-oxopropyl)-2,3-difluoroanilino)acetic acid

2-(N-(3-ethoxy-3-oxopropyl)-2,3-difluoroanilino)acetic acid (PubChem CID 23052753) has the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. Its IUPAC name is 2-(N-(3-ethoxy-3-oxopropyl)-2,3-difluoroanilino)acetic acid.

Molecular Properties

Compound Name2-(N-(3-ethoxy-3-oxopropyl)-2,3-difluoroanilino)acetic acid
PubChem CID23052753
Molecular FormulaC13H15F2NO4
Molecular Weight287.26 g/mol
Exact Mass287.10
IUPAC Name2-(N-(3-ethoxy-3-oxopropyl)-2,3-difluoroanilino)acetic acid
SMILESCCOC(=O)CCN(CC(=O)O)c1cccc(F)c1F
InChIInChI=1S/C13H15F2NO4/c1-2-20-12(19)6-7-16(8-11(17)18)10-5-3-4-9(14)13(10)15/h3-5H,2,6-8H2,1H3,(H,17,18)
InChIKeyWPYCTMFTBBLOQY-UHFFFAOYSA-N
XLogP1.81
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.26
LogP ≤ 51.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(N-(3-ethoxy-3-oxopropyl)-2,3-difluoroanilino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(N-(3-ethoxy-3-oxopropyl)-2,3-difluoroanilino)acetic acid?
The IUPAC name of 2-(N-(3-ethoxy-3-oxopropyl)-2,3-difluoroanilino)acetic acid (CID 23052753) is 2-(N-(3-ethoxy-3-oxopropyl)-2,3-difluoroanilino)acetic acid.
What is the SMILES notation for 2-(N-(3-ethoxy-3-oxopropyl)-2,3-difluoroanilino)acetic acid?
The canonical SMILES for 2-(N-(3-ethoxy-3-oxopropyl)-2,3-difluoroanilino)acetic acid is CCOC(=O)CCN(CC(=O)O)c1cccc(F)c1F.
What is the InChIKey of 2-(N-(3-ethoxy-3-oxopropyl)-2,3-difluoroanilino)acetic acid?
The InChIKey is WPYCTMFTBBLOQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2NO4/c1-2-20-12(19)6-7-16(8-11(17)18)10-5-3-4-9(14)13(10)15/h3-5H,2,6-8H2,1H3,(H,17,18).
What are the key properties of 2-(N-(3-ethoxy-3-oxopropyl)-2,3-difluoroanilino)acetic acid?
2-(N-(3-ethoxy-3-oxopropyl)-2,3-difluoroanilino)acetic acid has a molecular weight of 287.26 g/mol, XLogP of 1.81, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N-(3-ethoxy-3-oxopropyl)-2,3-difluoroanilino)acetic acid is sourced from PubChem (CID 23052753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).