2-(3,4-dibromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid

C13H15Br2NO4 — CID 23053150

IUPAC2-(3,4-dibromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid
SMILESCCOC(=O)CCN(CC(=O)O)c1ccc(Br)c(Br)c1
InChIInChI=1S/C13H15Br2NO4/c1-2-20-13(19)5-6-16(8-12(17)18)9-3-4-10(14)11(15)7-9/h3-4,7H,2,5-6,8H2,1H3,(H,17,18)
InChIKeyHRJKKPKBCNVSEH-UHFFFAOYSA-N
MW409.07 g/mol
LogP3.06
Rot. Bonds7

About 2-(3,4-dibromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid

2-(3,4-dibromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid (PubChem CID 23053150) has the molecular formula C13H15Br2NO4 and a molecular weight of 409.07 g/mol. Its IUPAC name is 2-(3,4-dibromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid.

Molecular Properties

Compound Name2-(3,4-dibromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid
PubChem CID23053150
Molecular FormulaC13H15Br2NO4
Molecular Weight409.07 g/mol
Exact Mass406.94
IUPAC Name2-(3,4-dibromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid
SMILESCCOC(=O)CCN(CC(=O)O)c1ccc(Br)c(Br)c1
InChIInChI=1S/C13H15Br2NO4/c1-2-20-13(19)5-6-16(8-12(17)18)9-3-4-10(14)11(15)7-9/h3-4,7H,2,5-6,8H2,1H3,(H,17,18)
InChIKeyHRJKKPKBCNVSEH-UHFFFAOYSA-N
XLogP3.06
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500409.07
LogP ≤ 53.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(3,4-dibromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-dibromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid?
The IUPAC name of 2-(3,4-dibromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid (CID 23053150) is 2-(3,4-dibromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid.
What is the SMILES notation for 2-(3,4-dibromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid?
The canonical SMILES for 2-(3,4-dibromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid is CCOC(=O)CCN(CC(=O)O)c1ccc(Br)c(Br)c1.
What is the InChIKey of 2-(3,4-dibromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid?
The InChIKey is HRJKKPKBCNVSEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Br2NO4/c1-2-20-13(19)5-6-16(8-12(17)18)9-3-4-10(14)11(15)7-9/h3-4,7H,2,5-6,8H2,1H3,(H,17,18).
What are the key properties of 2-(3,4-dibromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid?
2-(3,4-dibromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid has a molecular weight of 409.07 g/mol, XLogP of 3.06, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dibromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid is sourced from PubChem (CID 23053150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).