C13H14Br3NO4 — CID 23052904
2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid (PubChem CID 23052904) has the molecular formula C13H14Br3NO4 and a molecular weight of 487.97 g/mol. Its IUPAC name is 2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid.
| Compound Name | 2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid |
|---|---|
| PubChem CID | 23052904 |
| Molecular Formula | C13H14Br3NO4 |
| Molecular Weight | 487.97 g/mol |
| Exact Mass | 484.85 |
| IUPAC Name | 2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid |
| SMILES | CCOC(=O)CCN(CC(=O)O)c1cc(Br)c(Br)c(Br)c1 |
| InChI | InChI=1S/C13H14Br3NO4/c1-2-21-12(20)3-4-17(7-11(18)19)8-5-9(14)13(16)10(15)6-8/h5-6H,2-4,7H2,1H3,(H,18,19) |
| InChIKey | FOXSIMZBCOCGQL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.97 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|