2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid

C13H14Br3NO4 — CID 23052904

IUPAC2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid
SMILESCCOC(=O)CCN(CC(=O)O)c1cc(Br)c(Br)c(Br)c1
InChIInChI=1S/C13H14Br3NO4/c1-2-21-12(20)3-4-17(7-11(18)19)8-5-9(14)13(16)10(15)6-8/h5-6H,2-4,7H2,1H3,(H,18,19)
InChIKeyFOXSIMZBCOCGQL-UHFFFAOYSA-N
MW487.97 g/mol
LogP3.82
Rot. Bonds7

About 2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid

2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid (PubChem CID 23052904) has the molecular formula C13H14Br3NO4 and a molecular weight of 487.97 g/mol. Its IUPAC name is 2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid.

Molecular Properties

Compound Name2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid
PubChem CID23052904
Molecular FormulaC13H14Br3NO4
Molecular Weight487.97 g/mol
Exact Mass484.85
IUPAC Name2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid
SMILESCCOC(=O)CCN(CC(=O)O)c1cc(Br)c(Br)c(Br)c1
InChIInChI=1S/C13H14Br3NO4/c1-2-21-12(20)3-4-17(7-11(18)19)8-5-9(14)13(16)10(15)6-8/h5-6H,2-4,7H2,1H3,(H,18,19)
InChIKeyFOXSIMZBCOCGQL-UHFFFAOYSA-N
XLogP3.82
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500487.97
LogP ≤ 53.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid?
The IUPAC name of 2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid (CID 23052904) is 2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid.
What is the SMILES notation for 2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid?
The canonical SMILES for 2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid is CCOC(=O)CCN(CC(=O)O)c1cc(Br)c(Br)c(Br)c1.
What is the InChIKey of 2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid?
The InChIKey is FOXSIMZBCOCGQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Br3NO4/c1-2-21-12(20)3-4-17(7-11(18)19)8-5-9(14)13(16)10(15)6-8/h5-6H,2-4,7H2,1H3,(H,18,19).
What are the key properties of 2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid?
2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid has a molecular weight of 487.97 g/mol, XLogP of 3.82, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4,5-tribromo-N-(3-ethoxy-3-oxopropyl)anilino)acetic acid is sourced from PubChem (CID 23052904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).