C8H7F2NO2 — CID 67274769
(2,3-difluorophenyl)-methylcarbamic acid (PubChem CID 67274769) has the molecular formula C8H7F2NO2 and a molecular weight of 187.15 g/mol. Its IUPAC name is (2,3-difluorophenyl)-methylcarbamic acid.
| Compound Name | (2,3-difluorophenyl)-methylcarbamic acid |
|---|---|
| PubChem CID | 67274769 |
| Molecular Formula | C8H7F2NO2 |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | (2,3-difluorophenyl)-methylcarbamic acid |
| SMILES | CN(C(=O)O)c1cccc(F)c1F |
| InChI | InChI=1S/C8H7F2NO2/c1-11(8(12)13)6-4-2-3-5(9)7(6)10/h2-4H,1H3,(H,12,13) |
| InChIKey | GGHQDVQXHNKQTN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |