C11H12F5NO4Si — CID 90171777
N-[difluoro(trimethoxysilyl)methyl]-N,2,3-trifluorobenzamide (PubChem CID 90171777) has the molecular formula C11H12F5NO4Si and a molecular weight of 345.30 g/mol. Its IUPAC name is N-[difluoro(trimethoxysilyl)methyl]-N,2,3-trifluorobenzamide.
| Compound Name | N-[difluoro(trimethoxysilyl)methyl]-N,2,3-trifluorobenzamide |
|---|---|
| PubChem CID | 90171777 |
| Molecular Formula | C11H12F5NO4Si |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | N-[difluoro(trimethoxysilyl)methyl]-N,2,3-trifluorobenzamide |
| SMILES | CO[Si](OC)(OC)C(F)(F)N(F)C(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C11H12F5NO4Si/c1-19-22(20-2,21-3)11(14,15)17(16)10(18)7-5-4-6-8(12)9(7)13/h4-6H,1-3H3 |
| InChIKey | OPGRYODCLVVBOS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|