C13H17F2NO2 — CID 80710110
2,3-difluoro-N-methyl-N-(2-propan-2-yloxyethyl)benzamide (PubChem CID 80710110) has the molecular formula C13H17F2NO2 and a molecular weight of 257.28 g/mol. Its IUPAC name is 2,3-difluoro-N-methyl-N-(2-propan-2-yloxyethyl)benzamide.
| Compound Name | 2,3-difluoro-N-methyl-N-(2-propan-2-yloxyethyl)benzamide |
|---|---|
| PubChem CID | 80710110 |
| Molecular Formula | C13H17F2NO2 |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2,3-difluoro-N-methyl-N-(2-propan-2-yloxyethyl)benzamide |
| SMILES | CC(C)OCCN(C)C(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C13H17F2NO2/c1-9(2)18-8-7-16(3)13(17)10-5-4-6-11(14)12(10)15/h4-6,9H,7-8H2,1-3H3 |
| InChIKey | ZGLIQIKMFCLQCX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |