C13H18F2N2O — CID 63694509
N-[3-(dimethylamino)propyl]-2,3-difluoro-N-methylbenzamide (PubChem CID 63694509) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2,3-difluoro-N-methylbenzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2,3-difluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 63694509 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2,3-difluoro-N-methylbenzamide |
| SMILES | CN(C)CCCN(C)C(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C13H18F2N2O/c1-16(2)8-5-9-17(3)13(18)10-6-4-7-11(14)12(10)15/h4,6-7H,5,8-9H2,1-3H3 |
| InChIKey | NHSWFXDNTCSJLJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |