C14H18F5NO2Si — CID 90171111
N-[difluoro-[hydroxy-di(propan-2-yl)silyl]methyl]-N,2,3-trifluorobenzamide (PubChem CID 90171111) has the molecular formula C14H18F5NO2Si and a molecular weight of 355.38 g/mol. Its IUPAC name is N-[difluoro-[hydroxy-di(propan-2-yl)silyl]methyl]-N,2,3-trifluorobenzamide.
| Compound Name | N-[difluoro-[hydroxy-di(propan-2-yl)silyl]methyl]-N,2,3-trifluorobenzamide |
|---|---|
| PubChem CID | 90171111 |
| Molecular Formula | C14H18F5NO2Si |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-[difluoro-[hydroxy-di(propan-2-yl)silyl]methyl]-N,2,3-trifluorobenzamide |
| SMILES | CC(C)[Si](O)(C(C)C)C(F)(F)N(F)C(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C14H18F5NO2Si/c1-8(2)23(22,9(3)4)14(17,18)20(19)13(21)10-6-5-7-11(15)12(10)16/h5-9,22H,1-4H3 |
| InChIKey | SWDCLBSIBPTEKA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|