C10H11NO4 — CID 90916351
4-(2-nitroethenyl)-1,2-bis(trideuteriomethoxy)benzene (PubChem CID 90916351) has the molecular formula C10H11NO4 and a molecular weight of 215.24 g/mol. Its IUPAC name is 4-(2-nitroethenyl)-1,2-bis(trideuteriomethoxy)benzene.
| Compound Name | 4-(2-nitroethenyl)-1,2-bis(trideuteriomethoxy)benzene |
|---|---|
| PubChem CID | 90916351 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 4-(2-nitroethenyl)-1,2-bis(trideuteriomethoxy)benzene |
| SMILES | [2H]C([2H])([2H])Oc1ccc(C=C[N+](=O)[O-])cc1OC([2H])([2H])[2H] |
| InChI | InChI=1S/C10H11NO4/c1-14-9-4-3-8(5-6-11(12)13)7-10(9)15-2/h3-7H,1-2H3/i1D3,2D3 |
| InChIKey | SYJMYDMKPSZMSB-WFGJKAKNSA-N |
| XLogP | 1.95 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|