C24H23Cl2NO4 — CID 132579586
tert-butyl (1S,2R,3R)-6-benzyl-1-(3,4-dichlorophenyl)-4,5-dioxo-6-azaspiro[2.4]heptane-2-carboxylate (PubChem CID 132579586) has the molecular formula C24H23Cl2NO4 and a molecular weight of 460.36 g/mol. Its IUPAC name is tert-butyl (1S,2R,3R)-6-benzyl-1-(3,4-dichlorophenyl)-4,5-dioxo-6-azaspiro[2.4]heptane-2-carboxylate.
| Compound Name | tert-butyl (1S,2R,3R)-6-benzyl-1-(3,4-dichlorophenyl)-4,5-dioxo-6-azaspiro[2.4]heptane-2-carboxylate |
|---|---|
| PubChem CID | 132579586 |
| Molecular Formula | C24H23Cl2NO4 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | tert-butyl (1S,2R,3R)-6-benzyl-1-(3,4-dichlorophenyl)-4,5-dioxo-6-azaspiro[2.4]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1[C@@H](c2ccc(Cl)c(Cl)c2)[C@]12CN(Cc1ccccc1)C(=O)C2=O |
| InChI | InChI=1S/C24H23Cl2NO4/c1-23(2,3)31-22(30)19-18(15-9-10-16(25)17(26)11-15)24(19)13-27(21(29)20(24)28)12-14-7-5-4-6-8-14/h4-11,18-19H,12-13H2,1-3H3/t18-,19+,24-/m1/s1 |
| InChIKey | FEUVLFSEFBRRLC-YDIMBITNSA-N |
| XLogP | 4.65 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|