C20H17Cl2NO3 — CID 91447840
4-acetyl-5-(3,4-dichlorophenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione (PubChem CID 91447840) has the molecular formula C20H17Cl2NO3 and a molecular weight of 390.27 g/mol. Its IUPAC name is 4-acetyl-5-(3,4-dichlorophenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione.
| Compound Name | 4-acetyl-5-(3,4-dichlorophenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91447840 |
| Molecular Formula | C20H17Cl2NO3 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 4-acetyl-5-(3,4-dichlorophenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione |
| SMILES | CC(=O)C1C(=O)C(=O)N(CCc2ccccc2)C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H17Cl2NO3/c1-12(24)17-18(14-7-8-15(21)16(22)11-14)23(20(26)19(17)25)10-9-13-5-3-2-4-6-13/h2-8,11,17-18H,9-10H2,1H3 |
| InChIKey | AHXBCQKGTJQCOB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|