About 2-amino-3-benzyl-5-(3,4-dichlorophenyl)-6-methyl-6-(2-phenylethyl)-5H-pyrimidin-4-one
2-amino-3-benzyl-5-(3,4-dichlorophenyl)-6-methyl-6-(2-phenylethyl)-5H-pyrimidin-4-one (PubChem CID 44530186) has the molecular formula C26H25Cl2N3O
and a molecular weight of 466.41 g/mol. Its IUPAC name is 2-amino-3-benzyl-5-(3,4-dichlorophenyl)-6-methyl-6-(2-phenylethyl)-5H-pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-amino-3-benzyl-5-(3,4-dichlorophenyl)-6-methyl-6-(2-phenylethyl)-5H-pyrimidin-4-one |
| PubChem CID | 44530186 |
| Molecular Formula | C26H25Cl2N3O |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 2-amino-3-benzyl-5-(3,4-dichlorophenyl)-6-methyl-6-(2-phenylethyl)-5H-pyrimidin-4-one |
| SMILES | CC1(CCc2ccccc2)N=C(N)N(Cc2ccccc2)C(=O)C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H25Cl2N3O/c1-26(15-14-18-8-4-2-5-9-18)23(20-12-13-21(27)22(28)16-20)24(32)31(25(29)30-26)17-19-10-6-3-7-11-19/h2-13,16,23H,14-15,17H2,1H3,(H2,29,30) |
| InChIKey | AVDQZTGUMSWXAM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-3-benzyl-5-(3,4-dichlorophenyl)-6-methyl-6-(2-phenylethyl)-5H-pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-benzyl-5-(3,4-dichlorophenyl)-6-methyl-6-(2-phenylethyl)-5H-pyrimidin-4-one?
The IUPAC name of 2-amino-3-benzyl-5-(3,4-dichlorophenyl)-6-methyl-6-(2-phenylethyl)-5H-pyrimidin-4-one (CID 44530186) is 2-amino-3-benzyl-5-(3,4-dichlorophenyl)-6-methyl-6-(2-phenylethyl)-5H-pyrimidin-4-one.
What is the SMILES notation for 2-amino-3-benzyl-5-(3,4-dichlorophenyl)-6-methyl-6-(2-phenylethyl)-5H-pyrimidin-4-one?
The canonical SMILES for 2-amino-3-benzyl-5-(3,4-dichlorophenyl)-6-methyl-6-(2-phenylethyl)-5H-pyrimidin-4-one is CC1(CCc2ccccc2)N=C(N)N(Cc2ccccc2)C(=O)C1c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-amino-3-benzyl-5-(3,4-dichlorophenyl)-6-methyl-6-(2-phenylethyl)-5H-pyrimidin-4-one?
The InChIKey is AVDQZTGUMSWXAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25Cl2N3O/c1-26(15-14-18-8-4-2-5-9-18)23(20-12-13-21(27)22(28)16-20)24(32)31(25(29)30-26)17-19-10-6-3-7-11-19/h2-13,16,23H,14-15,17H2,1H3,(H2,29,30).
What are the key properties of 2-amino-3-benzyl-5-(3,4-dichlorophenyl)-6-methyl-6-(2-phenylethyl)-5H-pyrimidin-4-one?
2-amino-3-benzyl-5-(3,4-dichlorophenyl)-6-methyl-6-(2-phenylethyl)-5H-pyrimidin-4-one has a molecular weight of 466.41 g/mol, XLogP of 5.83, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-benzyl-5-(3,4-dichlorophenyl)-6-methyl-6-(2-phenylethyl)-5H-pyrimidin-4-one is sourced from PubChem (CID 44530186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).