C24H19Cl2NO3 — CID 135004670
(3S,4R)-1-benzyl-4-(4-chlorophenyl)-3-[(4-chlorophenyl)methyl]-3-hydroxypyrrolidine-2,5-dione (PubChem CID 135004670) has the molecular formula C24H19Cl2NO3 and a molecular weight of 440.33 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-4-(4-chlorophenyl)-3-[(4-chlorophenyl)methyl]-3-hydroxypyrrolidine-2,5-dione.
| Compound Name | (3S,4R)-1-benzyl-4-(4-chlorophenyl)-3-[(4-chlorophenyl)methyl]-3-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 135004670 |
| Molecular Formula | C24H19Cl2NO3 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | (3S,4R)-1-benzyl-4-(4-chlorophenyl)-3-[(4-chlorophenyl)methyl]-3-hydroxypyrrolidine-2,5-dione |
| SMILES | O=C1[C@H](c2ccc(Cl)cc2)[C@@](O)(Cc2ccc(Cl)cc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H19Cl2NO3/c25-19-10-6-16(7-11-19)14-24(30)21(18-8-12-20(26)13-9-18)22(28)27(23(24)29)15-17-4-2-1-3-5-17/h1-13,21,30H,14-15H2/t21-,24-/m0/s1 |
| InChIKey | PZUQVZVPCAVTDU-URXFXBBRSA-N |
| XLogP | 4.62 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|