About (3R,4R)-1-benzyl-4-(4-chlorophenyl)-6-phenyl-3-sulfanyl-3,4-dihydropyridin-2-one
(3R,4R)-1-benzyl-4-(4-chlorophenyl)-6-phenyl-3-sulfanyl-3,4-dihydropyridin-2-one (PubChem CID 102406767) has the molecular formula C24H20ClNOS
and a molecular weight of 405.95 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-4-(4-chlorophenyl)-6-phenyl-3-sulfanyl-3,4-dihydropyridin-2-one.
Molecular Properties
| Compound Name | (3R,4R)-1-benzyl-4-(4-chlorophenyl)-6-phenyl-3-sulfanyl-3,4-dihydropyridin-2-one |
| PubChem CID | 102406767 |
| Molecular Formula | C24H20ClNOS |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (3R,4R)-1-benzyl-4-(4-chlorophenyl)-6-phenyl-3-sulfanyl-3,4-dihydropyridin-2-one |
| SMILES | O=C1[C@H](S)[C@@H](c2ccc(Cl)cc2)C=C(c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H20ClNOS/c25-20-13-11-18(12-14-20)21-15-22(19-9-5-2-6-10-19)26(24(27)23(21)28)16-17-7-3-1-4-8-17/h1-15,21,23,28H,16H2/t21-,23-/m1/s1 |
| InChIKey | HHDNYUUUJYIXKY-FYYLOGMGSA-N |
| XLogP | 5.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3R,4R)-1-benzyl-4-(4-chlorophenyl)-6-phenyl-3-sulfanyl-3,4-dihydropyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-1-benzyl-4-(4-chlorophenyl)-6-phenyl-3-sulfanyl-3,4-dihydropyridin-2-one?
The IUPAC name of (3R,4R)-1-benzyl-4-(4-chlorophenyl)-6-phenyl-3-sulfanyl-3,4-dihydropyridin-2-one (CID 102406767) is (3R,4R)-1-benzyl-4-(4-chlorophenyl)-6-phenyl-3-sulfanyl-3,4-dihydropyridin-2-one.
What is the SMILES notation for (3R,4R)-1-benzyl-4-(4-chlorophenyl)-6-phenyl-3-sulfanyl-3,4-dihydropyridin-2-one?
The canonical SMILES for (3R,4R)-1-benzyl-4-(4-chlorophenyl)-6-phenyl-3-sulfanyl-3,4-dihydropyridin-2-one is O=C1[C@H](S)[C@@H](c2ccc(Cl)cc2)C=C(c2ccccc2)N1Cc1ccccc1.
What is the InChIKey of (3R,4R)-1-benzyl-4-(4-chlorophenyl)-6-phenyl-3-sulfanyl-3,4-dihydropyridin-2-one?
The InChIKey is HHDNYUUUJYIXKY-FYYLOGMGSA-N. The full InChI is InChI=1S/C24H20ClNOS/c25-20-13-11-18(12-14-20)21-15-22(19-9-5-2-6-10-19)26(24(27)23(21)28)16-17-7-3-1-4-8-17/h1-15,21,23,28H,16H2/t21-,23-/m1/s1.
What are the key properties of (3R,4R)-1-benzyl-4-(4-chlorophenyl)-6-phenyl-3-sulfanyl-3,4-dihydropyridin-2-one?
(3R,4R)-1-benzyl-4-(4-chlorophenyl)-6-phenyl-3-sulfanyl-3,4-dihydropyridin-2-one has a molecular weight of 405.95 g/mol, XLogP of 5.81, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-1-benzyl-4-(4-chlorophenyl)-6-phenyl-3-sulfanyl-3,4-dihydropyridin-2-one is sourced from PubChem (CID 102406767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).