C24H21NOS — CID 102406763
(3R,4R)-1-benzyl-4,6-diphenyl-3-sulfanyl-3,4-dihydropyridin-2-one (PubChem CID 102406763) has the molecular formula C24H21NOS and a molecular weight of 371.50 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-4,6-diphenyl-3-sulfanyl-3,4-dihydropyridin-2-one.
| Compound Name | (3R,4R)-1-benzyl-4,6-diphenyl-3-sulfanyl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 102406763 |
| Molecular Formula | C24H21NOS |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (3R,4R)-1-benzyl-4,6-diphenyl-3-sulfanyl-3,4-dihydropyridin-2-one |
| SMILES | O=C1[C@H](S)[C@@H](c2ccccc2)C=C(c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H21NOS/c26-24-23(27)21(19-12-6-2-7-13-19)16-22(20-14-8-3-9-15-20)25(24)17-18-10-4-1-5-11-18/h1-16,21,23,27H,17H2/t21-,23-/m1/s1 |
| InChIKey | NTNZWXLIQWCVRE-FYYLOGMGSA-N |
| XLogP | 5.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|