C25H22N2O — CID 100964466
(4S,5R)-1-benzyl-5-ethenyl-2,4-diphenyl-4,5-dihydropyrimidin-6-one (PubChem CID 100964466) has the molecular formula C25H22N2O and a molecular weight of 366.46 g/mol. Its IUPAC name is (4S,5R)-1-benzyl-5-ethenyl-2,4-diphenyl-4,5-dihydropyrimidin-6-one.
| Compound Name | (4S,5R)-1-benzyl-5-ethenyl-2,4-diphenyl-4,5-dihydropyrimidin-6-one |
|---|---|
| PubChem CID | 100964466 |
| Molecular Formula | C25H22N2O |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (4S,5R)-1-benzyl-5-ethenyl-2,4-diphenyl-4,5-dihydropyrimidin-6-one |
| SMILES | C=C[C@H]1C(=O)N(Cc2ccccc2)C(c2ccccc2)=N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H22N2O/c1-2-22-23(20-14-8-4-9-15-20)26-24(21-16-10-5-11-17-21)27(25(22)28)18-19-12-6-3-7-13-19/h2-17,22-23H,1,18H2/t22-,23-/m1/s1 |
| InChIKey | LLJCYUASPDNUOS-DHIUTWEWSA-N |
| XLogP | 5.02 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|