C26H22N2O — CID 101467115
(4R,5R)-1-benzyl-2,4-diphenyl-5-prop-2-ynyl-4,5-dihydropyrimidin-6-one (PubChem CID 101467115) has the molecular formula C26H22N2O and a molecular weight of 378.48 g/mol. Its IUPAC name is (4R,5R)-1-benzyl-2,4-diphenyl-5-prop-2-ynyl-4,5-dihydropyrimidin-6-one.
| Compound Name | (4R,5R)-1-benzyl-2,4-diphenyl-5-prop-2-ynyl-4,5-dihydropyrimidin-6-one |
|---|---|
| PubChem CID | 101467115 |
| Molecular Formula | C26H22N2O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (4R,5R)-1-benzyl-2,4-diphenyl-5-prop-2-ynyl-4,5-dihydropyrimidin-6-one |
| SMILES | C#CC[C@H]1C(=O)N(Cc2ccccc2)C(c2ccccc2)=N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C26H22N2O/c1-2-12-23-24(21-15-8-4-9-16-21)27-25(22-17-10-5-11-18-22)28(26(23)29)19-20-13-6-3-7-14-20/h1,3-11,13-18,23-24H,12,19H2/t23-,24+/m1/s1 |
| InChIKey | XPIDYIXHQNRCKD-RPWUZVMVSA-N |
| XLogP | 4.86 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|