C24H22N2O — CID 135011947
(3R,4R)-3-amino-1-benzyl-4,6-diphenyl-3,4-dihydropyridin-2-one (PubChem CID 135011947) has the molecular formula C24H22N2O and a molecular weight of 354.45 g/mol. Its IUPAC name is (3R,4R)-3-amino-1-benzyl-4,6-diphenyl-3,4-dihydropyridin-2-one.
| Compound Name | (3R,4R)-3-amino-1-benzyl-4,6-diphenyl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 135011947 |
| Molecular Formula | C24H22N2O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (3R,4R)-3-amino-1-benzyl-4,6-diphenyl-3,4-dihydropyridin-2-one |
| SMILES | N[C@H]1C(=O)N(Cc2ccccc2)C(c2ccccc2)=C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H22N2O/c25-23-21(19-12-6-2-7-13-19)16-22(20-14-8-3-9-15-20)26(24(23)27)17-18-10-4-1-5-11-18/h1-16,21,23H,17,25H2/t21-,23-/m1/s1 |
| InChIKey | GUUMKIAXTXMPLG-FYYLOGMGSA-N |
| XLogP | 4.18 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |