C40H29NO3 — CID 98048114
(1S,2S,6R,7S)-4-benzyl-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 98048114) has the molecular formula C40H29NO3 and a molecular weight of 571.68 g/mol. Its IUPAC name is (1S,2S,6R,7S)-4-benzyl-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | (1S,2S,6R,7S)-4-benzyl-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 98048114 |
| Molecular Formula | C40H29NO3 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | (1S,2S,6R,7S)-4-benzyl-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1Cc1ccccc1)[C@@]1(c3ccccc3)C(=O)[C@@]2(c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C40H29NO3/c42-36-34-35(37(43)41(36)26-27-16-6-1-7-17-27)40(31-24-14-5-15-25-31)33(29-20-10-3-11-21-29)32(28-18-8-2-9-19-28)39(34,38(40)44)30-22-12-4-13-23-30/h1-25,34-35H,26H2/t34-,35+,39-,40-/m0/s1 |
| InChIKey | QWXRRUNAFXLGRN-ZSAJNUMDSA-N |
| XLogP | 6.87 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|