C40H25Br2NO3 — CID 102210258
(1S,16R,17R,21S)-19-benzyl-6,11-dibromo-1,16-diphenyl-19-azahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3(8),4,6,9(14),10,12-heptaene-18,20,22-trione (PubChem CID 102210258) has the molecular formula C40H25Br2NO3 and a molecular weight of 727.45 g/mol. Its IUPAC name is (1S,16R,17R,21S)-19-benzyl-6,11-dibromo-1,16-diphenyl-19-azahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3(8),4,6,9(14),10,12-heptaene-18,20,22-trione.
| Compound Name | (1S,16R,17R,21S)-19-benzyl-6,11-dibromo-1,16-diphenyl-19-azahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3(8),4,6,9(14),10,12-heptaene-18,20,22-trione |
|---|---|
| PubChem CID | 102210258 |
| Molecular Formula | C40H25Br2NO3 |
| Molecular Weight | 727.45 g/mol |
| Exact Mass | 725.02 |
| IUPAC Name | (1S,16R,17R,21S)-19-benzyl-6,11-dibromo-1,16-diphenyl-19-azahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3(8),4,6,9(14),10,12-heptaene-18,20,22-trione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1Cc1ccccc1)[C@@]1(c3ccccc3)C(=O)[C@]2(c2ccccc2)c2c1c1ccc(Br)cc1c1cc(Br)ccc21 |
| InChI | InChI=1S/C40H25Br2NO3/c41-26-16-18-28-30(20-26)31-21-27(42)17-19-29(31)33-32(28)39(24-12-6-2-7-13-24)34-35(40(33,38(39)46)25-14-8-3-9-15-25)37(45)43(36(34)44)22-23-10-4-1-5-11-23/h1-21,34-35H,22H2/t34-,35+,39+,40- |
| InChIKey | XLSMRBCVPHIQQO-DFEXOLERSA-N |
| XLogP | 8.49 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.45 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|