C42H33NO5 — CID 100877668
(1R,2R,6R,7R)-4-benzyl-8,9-bis(4-methoxyphenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 100877668) has the molecular formula C42H33NO5 and a molecular weight of 631.73 g/mol. Its IUPAC name is (1R,2R,6R,7R)-4-benzyl-8,9-bis(4-methoxyphenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | (1R,2R,6R,7R)-4-benzyl-8,9-bis(4-methoxyphenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 100877668 |
| Molecular Formula | C42H33NO5 |
| Molecular Weight | 631.73 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | (1R,2R,6R,7R)-4-benzyl-8,9-bis(4-methoxyphenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | COc1ccc(C2=C(c3ccc(OC)cc3)[C@@]3(c4ccccc4)C(=O)[C@@]2(c2ccccc2)[C@@H]2C(=O)N(Cc4ccccc4)C(=O)[C@H]23)cc1 |
| InChI | InChI=1S/C42H33NO5/c1-47-32-22-18-28(19-23-32)34-35(29-20-24-33(48-2)25-21-29)42(31-16-10-5-11-17-31)37-36(41(34,40(42)46)30-14-8-4-9-15-30)38(44)43(39(37)45)26-27-12-6-3-7-13-27/h3-25,36-37H,26H2,1-2H3/t36-,37-,41+,42+/m0/s1 |
| InChIKey | PGRSSXGHBSYGDX-IEROYTCOSA-N |
| XLogP | 6.89 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.73 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|