C26H21BrN2O5 — CID 3856028
5-benzyl-1-(5-bromo-2-hydroxyphenyl)-4,6-dioxo-3-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3856028) has the molecular formula C26H21BrN2O5 and a molecular weight of 521.37 g/mol. Its IUPAC name is 5-benzyl-1-(5-bromo-2-hydroxyphenyl)-4,6-dioxo-3-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-benzyl-1-(5-bromo-2-hydroxyphenyl)-4,6-dioxo-3-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3856028 |
| Molecular Formula | C26H21BrN2O5 |
| Molecular Weight | 521.37 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | 5-benzyl-1-(5-bromo-2-hydroxyphenyl)-4,6-dioxo-3-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1C2C(c3cc(Br)ccc3O)NC(C(=O)O)(c3ccccc3)C2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C26H21BrN2O5/c27-17-11-12-19(30)18(13-17)22-20-21(26(28-22,25(33)34)16-9-5-2-6-10-16)24(32)29(23(20)31)14-15-7-3-1-4-8-15/h1-13,20-22,28,30H,14H2,(H,33,34) |
| InChIKey | BEOAIHLBTCJGIS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|