C34H28N2O4 — CID 3271081
5-benzyl-4,6-dioxo-3-phenyl-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3271081) has the molecular formula C34H28N2O4 and a molecular weight of 528.61 g/mol. Its IUPAC name is 5-benzyl-4,6-dioxo-3-phenyl-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-benzyl-4,6-dioxo-3-phenyl-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3271081 |
| Molecular Formula | C34H28N2O4 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 5-benzyl-4,6-dioxo-3-phenyl-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1C2C(c3ccc(C=Cc4ccccc4)cc3)NC(C(=O)O)(c3ccccc3)C2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C34H28N2O4/c37-31-28-29(32(38)36(31)22-25-12-6-2-7-13-25)34(33(39)40,27-14-8-3-9-15-27)35-30(28)26-20-18-24(19-21-26)17-16-23-10-4-1-5-11-23/h1-21,28-30,35H,22H2,(H,39,40) |
| InChIKey | IRYXNDNVDMFJJX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|