C33H32N2O6S — CID 3862411
5-[(4-methoxycarbonylphenyl)methyl]-3-(2-methylsulfanylethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3862411) has the molecular formula C33H32N2O6S and a molecular weight of 584.69 g/mol. Its IUPAC name is 5-[(4-methoxycarbonylphenyl)methyl]-3-(2-methylsulfanylethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-[(4-methoxycarbonylphenyl)methyl]-3-(2-methylsulfanylethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3862411 |
| Molecular Formula | C33H32N2O6S |
| Molecular Weight | 584.69 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | 5-[(4-methoxycarbonylphenyl)methyl]-3-(2-methylsulfanylethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COC(=O)c1ccc(CN2C(=O)C3C(c4ccc(C=Cc5ccccc5)cc4)NC(CCSC)(C(=O)O)C3C2=O)cc1 |
| InChI | InChI=1S/C33H32N2O6S/c1-41-31(38)25-16-12-23(13-17-25)20-35-29(36)26-27(30(35)37)33(32(39)40,18-19-42-2)34-28(26)24-14-10-22(11-15-24)9-8-21-6-4-3-5-7-21/h3-17,26-28,34H,18-20H2,1-2H3,(H,39,40) |
| InChIKey | FCSGZWMGLNNUAM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.69 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|