C30H24F3N3O9 — CID 3867074
5-[(4-methoxycarbonylphenyl)methyl]-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3867074) has the molecular formula C30H24F3N3O9 and a molecular weight of 627.53 g/mol. Its IUPAC name is 5-[(4-methoxycarbonylphenyl)methyl]-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-[(4-methoxycarbonylphenyl)methyl]-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3867074 |
| Molecular Formula | C30H24F3N3O9 |
| Molecular Weight | 627.53 g/mol |
| Exact Mass | 627.15 |
| IUPAC Name | 5-[(4-methoxycarbonylphenyl)methyl]-3-[(4-nitrophenyl)methyl]-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COC(=O)c1ccc(CN2C(=O)C3C(c4cccc(OC(F)(F)F)c4)NC(Cc4ccc([N+](=O)[O-])cc4)(C(=O)O)C3C2=O)cc1 |
| InChI | InChI=1S/C30H24F3N3O9/c1-44-27(39)18-9-5-17(6-10-18)15-35-25(37)22-23(26(35)38)29(28(40)41,14-16-7-11-20(12-8-16)36(42)43)34-24(22)19-3-2-4-21(13-19)45-30(31,32)33/h2-13,22-24,34H,14-15H2,1H3,(H,40,41) |
| InChIKey | YTNFFBMFIAQHLO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 165.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|