C27H27F3N2O6 — CID 5154076
5-cyclohexyl-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 5154076) has the molecular formula C27H27F3N2O6 and a molecular weight of 532.52 g/mol. Its IUPAC name is 5-cyclohexyl-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-cyclohexyl-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 5154076 |
| Molecular Formula | C27H27F3N2O6 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | 5-cyclohexyl-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1-[3-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1C2C(c3cccc(OC(F)(F)F)c3)NC(Cc3ccc(O)cc3)(C(=O)O)C2C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C27H27F3N2O6/c28-27(29,30)38-19-8-4-5-16(13-19)22-20-21(24(35)32(23(20)34)17-6-2-1-3-7-17)26(31-22,25(36)37)14-15-9-11-18(33)12-10-15/h4-5,8-13,17,20-22,31,33H,1-3,6-7,14H2,(H,36,37) |
| InChIKey | VZEHBNOCPOCWRV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|