C23H27F3N2O5 — CID 5156721
5-cyclohexyl-4,6-dioxo-3-propan-2-yl-1-[4-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 5156721) has the molecular formula C23H27F3N2O5 and a molecular weight of 468.47 g/mol. Its IUPAC name is 5-cyclohexyl-4,6-dioxo-3-propan-2-yl-1-[4-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-cyclohexyl-4,6-dioxo-3-propan-2-yl-1-[4-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 5156721 |
| Molecular Formula | C23H27F3N2O5 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 5-cyclohexyl-4,6-dioxo-3-propan-2-yl-1-[4-(trifluoromethoxy)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CC(C)C1(C(=O)O)NC(c2ccc(OC(F)(F)F)cc2)C2C(=O)N(C3CCCCC3)C(=O)C21 |
| InChI | InChI=1S/C23H27F3N2O5/c1-12(2)22(21(31)32)17-16(19(29)28(20(17)30)14-6-4-3-5-7-14)18(27-22)13-8-10-15(11-9-13)33-23(24,25)26/h8-12,14,16-18,27H,3-7H2,1-2H3,(H,31,32) |
| InChIKey | JSVRUYFEGMVIAV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|