C29H32N2O8 — CID 3848629
5-cyclohexyl-1-(3,5-dimethoxy-2-methoxycarbonylphenyl)-4,6-dioxo-3-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3848629) has the molecular formula C29H32N2O8 and a molecular weight of 536.58 g/mol. Its IUPAC name is 5-cyclohexyl-1-(3,5-dimethoxy-2-methoxycarbonylphenyl)-4,6-dioxo-3-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-cyclohexyl-1-(3,5-dimethoxy-2-methoxycarbonylphenyl)-4,6-dioxo-3-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3848629 |
| Molecular Formula | C29H32N2O8 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 5-cyclohexyl-1-(3,5-dimethoxy-2-methoxycarbonylphenyl)-4,6-dioxo-3-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COC(=O)c1c(OC)cc(OC)cc1C1NC(C(=O)O)(c2ccccc2)C2C(=O)N(C3CCCCC3)C(=O)C12 |
| InChI | InChI=1S/C29H32N2O8/c1-37-18-14-19(21(27(34)39-3)20(15-18)38-2)24-22-23(26(33)31(25(22)32)17-12-8-5-9-13-17)29(30-24,28(35)36)16-10-6-4-7-11-16/h4,6-7,10-11,14-15,17,22-24,30H,5,8-9,12-13H2,1-3H3,(H,35,36) |
| InChIKey | NXZSGNBHYNSRRF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|