C22H22N2O6 — CID 3839791
1-(2,4-dimethoxy-3-methylphenyl)-4,6-dioxo-3-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3839791) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is 1-(2,4-dimethoxy-3-methylphenyl)-4,6-dioxo-3-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(2,4-dimethoxy-3-methylphenyl)-4,6-dioxo-3-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3839791 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1-(2,4-dimethoxy-3-methylphenyl)-4,6-dioxo-3-phenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1ccc(C2NC(C(=O)O)(c3ccccc3)C3C(=O)NC(=O)C23)c(OC)c1C |
| InChI | InChI=1S/C22H22N2O6/c1-11-14(29-2)10-9-13(18(11)30-3)17-15-16(20(26)23-19(15)25)22(24-17,21(27)28)12-7-5-4-6-8-12/h4-10,15-17,24H,1-3H3,(H,27,28)(H,23,25,26) |
| InChIKey | FGZAOONYEFSNPZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|