C21H20N2O6 — CID 4985489
3-[(4-hydroxyphenyl)methyl]-1-(2-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 4985489) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is 3-[(4-hydroxyphenyl)methyl]-1-(2-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-[(4-hydroxyphenyl)methyl]-1-(2-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 4985489 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 3-[(4-hydroxyphenyl)methyl]-1-(2-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1ccccc1C1NC(Cc2ccc(O)cc2)(C(=O)O)C2C(=O)NC(=O)C12 |
| InChI | InChI=1S/C21H20N2O6/c1-29-14-5-3-2-4-13(14)17-15-16(19(26)22-18(15)25)21(23-17,20(27)28)10-11-6-8-12(24)9-7-11/h2-9,15-17,23-24H,10H2,1H3,(H,27,28)(H,22,25,26) |
| InChIKey | ZSDKHMBNYMRDLG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|