C35H34N2O6 — CID 3682269
5-(2,6-diethylphenyl)-3-[(4-hydroxyphenyl)methyl]-1-(4-methoxynaphthalen-1-yl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3682269) has the molecular formula C35H34N2O6 and a molecular weight of 578.67 g/mol. Its IUPAC name is 5-(2,6-diethylphenyl)-3-[(4-hydroxyphenyl)methyl]-1-(4-methoxynaphthalen-1-yl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(2,6-diethylphenyl)-3-[(4-hydroxyphenyl)methyl]-1-(4-methoxynaphthalen-1-yl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3682269 |
| Molecular Formula | C35H34N2O6 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | 5-(2,6-diethylphenyl)-3-[(4-hydroxyphenyl)methyl]-1-(4-methoxynaphthalen-1-yl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCc1cccc(CC)c1N1C(=O)C2C(c3ccc(OC)c4ccccc34)NC(Cc3ccc(O)cc3)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C35H34N2O6/c1-4-21-9-8-10-22(5-2)31(21)37-32(39)28-29(33(37)40)35(34(41)42,19-20-13-15-23(38)16-14-20)36-30(28)26-17-18-27(43-3)25-12-7-6-11-24(25)26/h6-18,28-30,36,38H,4-5,19H2,1-3H3,(H,41,42) |
| InChIKey | XVVNRCPGDMQIBZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|