C38H38N2O7 — CID 3680551
5-(2,6-diethylphenyl)-3-[(4-hydroxyphenyl)methyl]-1-(3-methoxy-2-phenylmethoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3680551) has the molecular formula C38H38N2O7 and a molecular weight of 634.73 g/mol. Its IUPAC name is 5-(2,6-diethylphenyl)-3-[(4-hydroxyphenyl)methyl]-1-(3-methoxy-2-phenylmethoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(2,6-diethylphenyl)-3-[(4-hydroxyphenyl)methyl]-1-(3-methoxy-2-phenylmethoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3680551 |
| Molecular Formula | C38H38N2O7 |
| Molecular Weight | 634.73 g/mol |
| Exact Mass | 634.27 |
| IUPAC Name | 5-(2,6-diethylphenyl)-3-[(4-hydroxyphenyl)methyl]-1-(3-methoxy-2-phenylmethoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCc1cccc(CC)c1N1C(=O)C2C(c3cccc(OC)c3OCc3ccccc3)NC(Cc3ccc(O)cc3)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C38H38N2O7/c1-4-25-13-9-14-26(5-2)33(25)40-35(42)30-31(36(40)43)38(37(44)45,21-23-17-19-27(41)20-18-23)39-32(30)28-15-10-16-29(46-3)34(28)47-22-24-11-7-6-8-12-24/h6-20,30-32,39,41H,4-5,21-22H2,1-3H3,(H,44,45) |
| InChIKey | LHTLXYQILUNVNS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.73 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|