C36H32N2O6 — CID 3276821
5-but-3-ynyl-1-(3-methoxy-2-phenylmethoxyphenyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3276821) has the molecular formula C36H32N2O6 and a molecular weight of 588.66 g/mol. Its IUPAC name is 5-but-3-ynyl-1-(3-methoxy-2-phenylmethoxyphenyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-but-3-ynyl-1-(3-methoxy-2-phenylmethoxyphenyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3276821 |
| Molecular Formula | C36H32N2O6 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | 5-but-3-ynyl-1-(3-methoxy-2-phenylmethoxyphenyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | C#CCCN1C(=O)C2C(c3cccc(OC)c3OCc3ccccc3)NC(Cc3ccc4ccccc4c3)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C36H32N2O6/c1-3-4-19-38-33(39)29-30(34(38)40)36(35(41)42,21-24-17-18-25-13-8-9-14-26(25)20-24)37-31(29)27-15-10-16-28(43-2)32(27)44-22-23-11-6-5-7-12-23/h1,5-18,20,29-31,37H,4,19,21-22H2,2H3,(H,41,42) |
| InChIKey | DUCZYKSMORJIFO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|