C41H36N2O6 — CID 134081754
1-(3-methoxy-2-phenylmethoxyphenyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-5-[(Z)-3-phenylprop-2-enyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 134081754) has the molecular formula C41H36N2O6 and a molecular weight of 652.75 g/mol. Its IUPAC name is 1-(3-methoxy-2-phenylmethoxyphenyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-5-[(Z)-3-phenylprop-2-enyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(3-methoxy-2-phenylmethoxyphenyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-5-[(Z)-3-phenylprop-2-enyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 134081754 |
| Molecular Formula | C41H36N2O6 |
| Molecular Weight | 652.75 g/mol |
| Exact Mass | 652.26 |
| IUPAC Name | 1-(3-methoxy-2-phenylmethoxyphenyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-5-[(Z)-3-phenylprop-2-enyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1cccc(C2NC(Cc3ccc4ccccc4c3)(C(=O)O)C3C(=O)N(C/C=C\c4ccccc4)C(=O)C23)c1OCc1ccccc1 |
| InChI | InChI=1S/C41H36N2O6/c1-48-33-20-10-19-32(37(33)49-26-28-14-6-3-7-15-28)36-34-35(39(45)43(38(34)44)23-11-16-27-12-4-2-5-13-27)41(42-36,40(46)47)25-29-21-22-30-17-8-9-18-31(30)24-29/h2-22,24,34-36,42H,23,25-26H2,1H3,(H,46,47)/b16-11- |
| InChIKey | RZYRHRRKPQBJBH-WJDWOHSUSA-N |
| XLogP | 6.45 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.75 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|