C40H34N2O5 — CID 3802215
3-(naphthalen-2-ylmethyl)-4,6-dioxo-5-(2-phenoxyethyl)-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3802215) has the molecular formula C40H34N2O5 and a molecular weight of 622.72 g/mol. Its IUPAC name is 3-(naphthalen-2-ylmethyl)-4,6-dioxo-5-(2-phenoxyethyl)-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-(naphthalen-2-ylmethyl)-4,6-dioxo-5-(2-phenoxyethyl)-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3802215 |
| Molecular Formula | C40H34N2O5 |
| Molecular Weight | 622.72 g/mol |
| Exact Mass | 622.25 |
| IUPAC Name | 3-(naphthalen-2-ylmethyl)-4,6-dioxo-5-(2-phenoxyethyl)-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1C2C(c3ccc(C=Cc4ccccc4)cc3)NC(Cc3ccc4ccccc4c3)(C(=O)O)C2C(=O)N1CCOc1ccccc1 |
| InChI | InChI=1S/C40H34N2O5/c43-37-34-35(38(44)42(37)23-24-47-33-13-5-2-6-14-33)40(39(45)46,26-29-19-20-30-11-7-8-12-32(30)25-29)41-36(34)31-21-17-28(18-22-31)16-15-27-9-3-1-4-10-27/h1-22,25,34-36,41H,23-24,26H2,(H,45,46) |
| InChIKey | YLHJOICSBRIDSU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.72 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|