C27H23F3N2O5 — CID 3738786
5-(2-hydroxyethyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-1-[3-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3738786) has the molecular formula C27H23F3N2O5 and a molecular weight of 512.48 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-1-[3-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(2-hydroxyethyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-1-[3-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3738786 |
| Molecular Formula | C27H23F3N2O5 |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 5-(2-hydroxyethyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-1-[3-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1C2C(c3cccc(C(F)(F)F)c3)NC(Cc3ccc4ccccc4c3)(C(=O)O)C2C(=O)N1CCO |
| InChI | InChI=1S/C27H23F3N2O5/c28-27(29,30)19-7-3-6-18(13-19)22-20-21(24(35)32(10-11-33)23(20)34)26(31-22,25(36)37)14-15-8-9-16-4-1-2-5-17(16)12-15/h1-9,12-13,20-22,31,33H,10-11,14H2,(H,36,37) |
| InChIKey | JSENBTPUZJPZAL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|