C35H32N6O8 — CID 3802212
5-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl]-1-(4-methoxycarbonylphenyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3802212) has the molecular formula C35H32N6O8 and a molecular weight of 664.68 g/mol. Its IUPAC name is 5-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl]-1-(4-methoxycarbonylphenyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl]-1-(4-methoxycarbonylphenyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3802212 |
| Molecular Formula | C35H32N6O8 |
| Molecular Weight | 664.68 g/mol |
| Exact Mass | 664.23 |
| IUPAC Name | 5-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl]-1-(4-methoxycarbonylphenyl)-3-(naphthalen-2-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COC(=O)c1ccc(C2NC(Cc3ccc4ccccc4c3)(C(=O)O)C3C(=O)N(CCn4cnc5c4c(=O)n(C)c(=O)n5C)C(=O)C23)cc1 |
| InChI | InChI=1S/C35H32N6O8/c1-38-28-27(31(44)39(2)34(38)48)40(18-36-28)14-15-41-29(42)24-25(30(41)43)35(33(46)47,17-19-8-9-20-6-4-5-7-23(20)16-19)37-26(24)21-10-12-22(13-11-21)32(45)49-3/h4-13,16,18,24-26,37H,14-15,17H2,1-3H3,(H,46,47) |
| InChIKey | PYRBGEYRNWSCSM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 174.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.68 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|