C30H28N2O7 — CID 4988198
5-(4-ethylphenyl)-3-[(4-hydroxyphenyl)methyl]-1-(4-methoxycarbonylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 4988198) has the molecular formula C30H28N2O7 and a molecular weight of 528.56 g/mol. Its IUPAC name is 5-(4-ethylphenyl)-3-[(4-hydroxyphenyl)methyl]-1-(4-methoxycarbonylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(4-ethylphenyl)-3-[(4-hydroxyphenyl)methyl]-1-(4-methoxycarbonylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 4988198 |
| Molecular Formula | C30H28N2O7 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 5-(4-ethylphenyl)-3-[(4-hydroxyphenyl)methyl]-1-(4-methoxycarbonylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCc1ccc(N2C(=O)C3C(c4ccc(C(=O)OC)cc4)NC(Cc4ccc(O)cc4)(C(=O)O)C3C2=O)cc1 |
| InChI | InChI=1S/C30H28N2O7/c1-3-17-4-12-21(13-5-17)32-26(34)23-24(27(32)35)30(29(37)38,16-18-6-14-22(33)15-7-18)31-25(23)19-8-10-20(11-9-19)28(36)39-2/h4-15,23-25,31,33H,3,16H2,1-2H3,(H,37,38) |
| InChIKey | KMQMWRSEPCZWEF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|