C32H29N3O6 — CID 3821992
5-(4-ethylphenyl)-3-(1H-indol-3-ylmethyl)-1-(4-methoxycarbonylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3821992) has the molecular formula C32H29N3O6 and a molecular weight of 551.60 g/mol. Its IUPAC name is 5-(4-ethylphenyl)-3-(1H-indol-3-ylmethyl)-1-(4-methoxycarbonylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(4-ethylphenyl)-3-(1H-indol-3-ylmethyl)-1-(4-methoxycarbonylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3821992 |
| Molecular Formula | C32H29N3O6 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 5-(4-ethylphenyl)-3-(1H-indol-3-ylmethyl)-1-(4-methoxycarbonylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCc1ccc(N2C(=O)C3C(c4ccc(C(=O)OC)cc4)NC(Cc4c[nH]c5ccccc45)(C(=O)O)C3C2=O)cc1 |
| InChI | InChI=1S/C32H29N3O6/c1-3-18-8-14-22(15-9-18)35-28(36)25-26(29(35)37)32(31(39)40,16-21-17-33-24-7-5-4-6-23(21)24)34-27(25)19-10-12-20(13-11-19)30(38)41-2/h4-15,17,25-27,33-34H,3,16H2,1-2H3,(H,39,40) |
| InChIKey | PUNCMQFVBFFFNG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|