C30H24N4O8 — CID 3821994
3-(1H-indol-3-ylmethyl)-1-(4-methoxycarbonylphenyl)-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3821994) has the molecular formula C30H24N4O8 and a molecular weight of 568.54 g/mol. Its IUPAC name is 3-(1H-indol-3-ylmethyl)-1-(4-methoxycarbonylphenyl)-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-(1H-indol-3-ylmethyl)-1-(4-methoxycarbonylphenyl)-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3821994 |
| Molecular Formula | C30H24N4O8 |
| Molecular Weight | 568.54 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | 3-(1H-indol-3-ylmethyl)-1-(4-methoxycarbonylphenyl)-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COC(=O)c1ccc(C2NC(Cc3c[nH]c4ccccc34)(C(=O)O)C3C(=O)N(c4cccc([N+](=O)[O-])c4)C(=O)C23)cc1 |
| InChI | InChI=1S/C30H24N4O8/c1-42-28(37)17-11-9-16(10-12-17)25-23-24(27(36)33(26(23)35)19-5-4-6-20(13-19)34(40)41)30(32-25,29(38)39)14-18-15-31-22-8-3-2-7-21(18)22/h2-13,15,23-25,31-32H,14H2,1H3,(H,38,39) |
| InChIKey | UPMWUSOVRIEAQE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 171.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.54 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|