C28H22FN3O5 — CID 4906048
5-(3-fluorophenyl)-1-(2-hydroxyphenyl)-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 4906048) has the molecular formula C28H22FN3O5 and a molecular weight of 499.50 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-1-(2-hydroxyphenyl)-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(3-fluorophenyl)-1-(2-hydroxyphenyl)-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 4906048 |
| Molecular Formula | C28H22FN3O5 |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 5-(3-fluorophenyl)-1-(2-hydroxyphenyl)-3-(1H-indol-3-ylmethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1C2C(c3ccccc3O)NC(Cc3c[nH]c4ccccc34)(C(=O)O)C2C(=O)N1c1cccc(F)c1 |
| InChI | InChI=1S/C28H22FN3O5/c29-16-6-5-7-17(12-16)32-25(34)22-23(26(32)35)28(27(36)37,31-24(22)19-9-2-4-11-21(19)33)13-15-14-30-20-10-3-1-8-18(15)20/h1-12,14,22-24,30-31,33H,13H2,(H,36,37) |
| InChIKey | UOQWNZQMXPSQNZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|