C29H21N5O6 — CID 4678203
1-(4-cyanophenyl)-3-(1H-indol-3-ylmethyl)-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 4678203) has the molecular formula C29H21N5O6 and a molecular weight of 535.52 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-(1H-indol-3-ylmethyl)-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(4-cyanophenyl)-3-(1H-indol-3-ylmethyl)-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 4678203 |
| Molecular Formula | C29H21N5O6 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | 1-(4-cyanophenyl)-3-(1H-indol-3-ylmethyl)-5-(3-nitrophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | N#Cc1ccc(C2NC(Cc3c[nH]c4ccccc34)(C(=O)O)C3C(=O)N(c4cccc([N+](=O)[O-])c4)C(=O)C23)cc1 |
| InChI | InChI=1S/C29H21N5O6/c30-14-16-8-10-17(11-9-16)25-23-24(27(36)33(26(23)35)19-4-3-5-20(12-19)34(39)40)29(32-25,28(37)38)13-18-15-31-22-7-2-1-6-21(18)22/h1-12,15,23-25,31-32H,13H2,(H,37,38) |
| InChIKey | UQYWTOSUNLRXPL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|