C28H22ClN3O4 — CID 3781671
3-benzyl-5-(3-chloro-4-methylphenyl)-1-(4-cyanophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3781671) has the molecular formula C28H22ClN3O4 and a molecular weight of 499.95 g/mol. Its IUPAC name is 3-benzyl-5-(3-chloro-4-methylphenyl)-1-(4-cyanophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-benzyl-5-(3-chloro-4-methylphenyl)-1-(4-cyanophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3781671 |
| Molecular Formula | C28H22ClN3O4 |
| Molecular Weight | 499.95 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 3-benzyl-5-(3-chloro-4-methylphenyl)-1-(4-cyanophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | Cc1ccc(N2C(=O)C3C(c4ccc(C#N)cc4)NC(Cc4ccccc4)(C(=O)O)C3C2=O)cc1Cl |
| InChI | InChI=1S/C28H22ClN3O4/c1-16-7-12-20(13-21(16)29)32-25(33)22-23(26(32)34)28(27(35)36,14-17-5-3-2-4-6-17)31-24(22)19-10-8-18(15-30)9-11-19/h2-13,22-24,31H,14H2,1H3,(H,35,36) |
| InChIKey | XDKPPLZYRNXYOE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.95 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|