C23H23ClN2O6 — CID 3737952
5-(3-chloro-4-methylphenyl)-1-(4-hydroxy-3,5-dimethylphenyl)-3-(hydroxymethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3737952) has the molecular formula C23H23ClN2O6 and a molecular weight of 458.90 g/mol. Its IUPAC name is 5-(3-chloro-4-methylphenyl)-1-(4-hydroxy-3,5-dimethylphenyl)-3-(hydroxymethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(3-chloro-4-methylphenyl)-1-(4-hydroxy-3,5-dimethylphenyl)-3-(hydroxymethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3737952 |
| Molecular Formula | C23H23ClN2O6 |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 5-(3-chloro-4-methylphenyl)-1-(4-hydroxy-3,5-dimethylphenyl)-3-(hydroxymethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | Cc1ccc(N2C(=O)C3C(c4cc(C)c(O)c(C)c4)NC(CO)(C(=O)O)C3C2=O)cc1Cl |
| InChI | InChI=1S/C23H23ClN2O6/c1-10-4-5-14(8-15(10)24)26-20(29)16-17(21(26)30)23(9-27,22(31)32)25-18(16)13-6-11(2)19(28)12(3)7-13/h4-8,16-18,25,27-28H,9H2,1-3H3,(H,31,32) |
| InChIKey | AKEIEJGMRHDYNP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|