C26H29ClN2O5 — CID 3778052
3-butan-2-yl-5-(3-chloro-4-methylphenyl)-1-(4-hydroxy-3,5-dimethylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3778052) has the molecular formula C26H29ClN2O5 and a molecular weight of 484.98 g/mol. Its IUPAC name is 3-butan-2-yl-5-(3-chloro-4-methylphenyl)-1-(4-hydroxy-3,5-dimethylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-butan-2-yl-5-(3-chloro-4-methylphenyl)-1-(4-hydroxy-3,5-dimethylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3778052 |
| Molecular Formula | C26H29ClN2O5 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 3-butan-2-yl-5-(3-chloro-4-methylphenyl)-1-(4-hydroxy-3,5-dimethylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCC(C)C1(C(=O)O)NC(c2cc(C)c(O)c(C)c2)C2C(=O)N(c3ccc(C)c(Cl)c3)C(=O)C21 |
| InChI | InChI=1S/C26H29ClN2O5/c1-6-15(5)26(25(33)34)20-19(21(28-26)16-9-13(3)22(30)14(4)10-16)23(31)29(24(20)32)17-8-7-12(2)18(27)11-17/h7-11,15,19-21,28,30H,6H2,1-5H3,(H,33,34) |
| InChIKey | LBYXEYNRJHZTPE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|