C25H27ClN2O6 — CID 3769181
3-butan-2-yl-5-(3-chloro-4-methylphenyl)-1-(2-hydroxy-3-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3769181) has the molecular formula C25H27ClN2O6 and a molecular weight of 486.95 g/mol. Its IUPAC name is 3-butan-2-yl-5-(3-chloro-4-methylphenyl)-1-(2-hydroxy-3-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-butan-2-yl-5-(3-chloro-4-methylphenyl)-1-(2-hydroxy-3-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3769181 |
| Molecular Formula | C25H27ClN2O6 |
| Molecular Weight | 486.95 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 3-butan-2-yl-5-(3-chloro-4-methylphenyl)-1-(2-hydroxy-3-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCC(C)C1(C(=O)O)NC(c2cccc(OC)c2O)C2C(=O)N(c3ccc(C)c(Cl)c3)C(=O)C21 |
| InChI | InChI=1S/C25H27ClN2O6/c1-5-13(3)25(24(32)33)19-18(20(27-25)15-7-6-8-17(34-4)21(15)29)22(30)28(23(19)31)14-10-9-12(2)16(26)11-14/h6-11,13,18-20,27,29H,5H2,1-4H3,(H,32,33) |
| InChIKey | LQTBDMCZZGJAFW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.95 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|