C25H28N2O5 — CID 3353905
5-benzyl-3-butan-2-yl-1-(2-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3353905) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 5-benzyl-3-butan-2-yl-1-(2-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-benzyl-3-butan-2-yl-1-(2-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3353905 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 5-benzyl-3-butan-2-yl-1-(2-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCC(C)C1(C(=O)O)NC(c2ccccc2OC)C2C(=O)N(Cc3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C25H28N2O5/c1-4-15(2)25(24(30)31)20-19(21(26-25)17-12-8-9-13-18(17)32-3)22(28)27(23(20)29)14-16-10-6-5-7-11-16/h5-13,15,19-21,26H,4,14H2,1-3H3,(H,30,31) |
| InChIKey | LPSYOUMSSIRJIB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|